# Campaign Stopping Based on the insights from [this other example](/examples/Custom_Hooks/probability_of_improvement), we now demonstrate how to leverage the {func}`register_hooks ` mechanics to interrupt a running campaign based on a simple *Probability of Improvement (PI)* criterion. This approach could be used, for instance, to terminate unpromising campaigns early and refine their search spaces, or to end an ongoing optimization if the found results are sufficiently good. The underlying use case is taken from the example shown [here](/examples/Backtesting/full_lookup). ```python ### Imports import math import os import warnings ``` ```python import pandas as pd import seaborn as sns ``` ```python from baybe import Campaign from baybe.acquisition import ProbabilityOfImprovement from baybe.exceptions import UnusedObjectWarning from baybe.objectives import SingleTargetObjective from baybe.objectives.base import Objective from baybe.parameters import NumericalDiscreteParameter, SubstanceParameter from baybe.recommenders import ( BotorchRecommender, RandomRecommender, TwoPhaseMetaRecommender, ) from baybe.searchspace import SearchSpace, SearchSpaceType from baybe.simulation import simulate_scenarios from baybe.targets import NumericalTarget from baybe.utils import register_hooks from examples.utils import create_example_plots ``` ```python ### Temporary warnings.filterwarnings( "ignore", category=UnusedObjectWarning, message="explicit objective" ) warnings.filterwarnings("ignore", category=DeprecationWarning) ``` ## Settings Let's start by defining some basic settings required for the example: ```python SMOKE_TEST = "SMOKE_TEST" in os.environ N_DOE_ITERATIONS = 2 if SMOKE_TEST else 25 N_MC_ITERATIONS = 2 if SMOKE_TEST else 20 N_INTERRUPTED_CAMPAIGNS = 2 if SMOKE_TEST else 5 BATCH_SIZE = 1 RANDOM_SEED = 1337 ``` ## Problem Definition and Lookup Functionality We load the dataframe containing the lookup data for the closed-loop simulation: ```python try: lookup = pd.read_csv("benchmarks/data/direct_arylation/data.csv") except FileNotFoundError as e: lookup = pd.read_csv("../../../benchmarks/data/direct_arylation/data.csv") print(e) ``` [Errno 2] No such file or directory: 'benchmarks/data/direct_arylation/data.csv' Following the setup described [here](../Backtesting/full_lookup.md), we create the building blocks for the optimization problem: ```python solvent_data = dict(set(zip(lookup.Solvent, lookup.Solvent_SMILES))) base_data = dict(set(zip(lookup.Base, lookup.Base_SMILES))) ligand_data = dict(set(zip(lookup.Ligand, lookup.Ligand_SMILES))) temperature_values = set(lookup.Temp_C) concentration_values = set(lookup.Concentration) ``` ```python parameters = [ SubstanceParameter(name="Solvent", data=solvent_data, encoding="MORDRED"), SubstanceParameter(name="Base", data=base_data, encoding="MORDRED"), SubstanceParameter(name="Ligand", data=ligand_data, encoding="MORDRED"), NumericalDiscreteParameter(name="Temp_C", values=temperature_values, tolerance=2), NumericalDiscreteParameter(name="Concentration", values=concentration_values), ] ``` ```python searchspace = SearchSpace.from_product(parameters=parameters) ``` ________________________________________________________________________________ [Memory] Calling baybe.utils.chemistry._molecule_to_fingerprint_features... _molecule_to_fingerprint_features('C[C@]1(O2)O[C@](C[C@]2(C)P3C4=CC=CC=C4)(C)O[C@]3(C)C1', MordredFingerprint()) _________________________________molecule_to_fingerprint_features - 0.3s, 0.0min ```python objective = SingleTargetObjective(target=NumericalTarget(name="yield")) ``` ```python recommender = TwoPhaseMetaRecommender( initial_recommender=RandomRecommender(), recommender=BotorchRecommender() ) ``` ## Simulating the Uninterrupted Campaigns First, we run several Monte Carlo repetitions of the uninterrupted campaign to get a feeling for the average trajectory. For reproducibility, we also fix the random seed: ```python campaign = Campaign(searchspace, objective, recommender) results_uninterrupted = simulate_scenarios( {"Average uninterrupted": campaign}, lookup, batch_size=BATCH_SIZE, n_doe_iterations=N_DOE_ITERATIONS, n_mc_iterations=N_MC_ITERATIONS, random_seed=RANDOM_SEED, ) ``` ## Defining the Campaign-Stopping Hook In order to interrupt a running campaign, we define a custom exception to identify our stopping event: ```python class CampaignStoppedException(Exception): """The campaign should be stopped.""" ``` Based on this exception class, we can now define a hook implementing the stopping criterion. For this purpose, we count the fraction of candidates with a PI exceeding a given value and terminate the campaign once the fraction falls below a certain threshold. ```python PI_THRESHOLD = 0.01 # PI of 1% to identify promising points PI_REQUIRED_FRACTION = 0.2 # 20% of candidates must be above the threshold ``` ```python def stop_on_PI( self: BotorchRecommender, searchspace: SearchSpace, objective: Objective | None = None, measurements: pd.DataFrame | None = None, ) -> None: """Raise an exception if the PI-based stopping criterion is fulfilled.""" if searchspace.type != SearchSpaceType.DISCRETE: raise TypeError( f"Search spaces of type '{searchspace.type}' are not supported. " f"Currently, only search spaces of type '{SearchSpaceType.DISCRETE}' are " f"accepted." ) candidates, _ = searchspace.discrete.get_candidates() acqf = ProbabilityOfImprovement() pi = self.acquisition_values( candidates, searchspace, objective, measurements, acquisition_function=acqf ) n_pis_over = (pi > PI_THRESHOLD).sum() n_pis_over_required = math.ceil(len(pi) * PI_REQUIRED_FRACTION) if n_pis_over < n_pis_over_required: raise CampaignStoppedException( f"Less than {PI_REQUIRED_FRACTION * 100:.0f}% of candidates are above the PI " f"threshold of {PI_THRESHOLD * 100:.0f}% - Stopping the campaign." ) ``` Now, we attach the hook to the ``recommend`` function of our recommender class: ```python BotorchRecommender.recommend = register_hooks( BotorchRecommender.recommend, post_hooks=[stop_on_PI] ) ``` ```{admonition} Monkeypatching :class: note The above monkeypatch registers the hook with all future instances of the recommender class. While it is possible to attach the hook only to a specific instance via ``MethodType`` (see [here](./basics.md)), this approach does not work well with the simulation utilities because they internally create deep copies of the simulated campaign, effectively bypassing the patch. ``` ## Simulating the Interrupted Campaigns With the hook attached to the class, we again run several Monte Carlo repetitions of the same campaign. For this purpose, we instantiate a new recommender with the active hook and assign it to a fresh copy of the campaign: ```python recommender_with_hook = TwoPhaseMetaRecommender( initial_recommender=RandomRecommender(), recommender=BotorchRecommender() ) campaign_with_hook = Campaign(searchspace, objective, recommender) ``` Now, we can simply re-trigger the simulation loop. In order to establish a 1:1 comparison, we use the same random seed as before so that the initial states of all trajectories are aligned with the previous runs: ```python results_interrupted = simulate_scenarios( {"Interrupted": campaign_with_hook}, lookup, batch_size=BATCH_SIZE, n_doe_iterations=N_DOE_ITERATIONS, n_mc_iterations=N_INTERRUPTED_CAMPAIGNS, random_seed=RANDOM_SEED, ) ``` ```{note} If an exception is thrown inside the loop, the function still returns the partial trajectory, which effectively implements early stopping. ``` ## Plotting the Results Finally, we plot both the interrupted and the uninterrupted results. To display the latter in terms of individual trajectories, we can leverage the column that keeps track of the Monte Carlo iterations: ```python results_interrupted = results_interrupted.drop("Scenario", axis=1) results_interrupted["Scenario"] = results_interrupted["Monte_Carlo_Run"].apply( lambda k: f"PI-stopped, run {k}" ) ``` Now, we can easily create the plot from a single combined dataframe: ```python results = pd.concat([results_uninterrupted, results_interrupted]) ax = sns.lineplot( data=results, marker="o", markersize=10, x="Num_Experiments", y="yield_CumBest", hue="Scenario", ) for line in ax.get_lines()[1:]: line.set_dashes([5, 2]) create_example_plots(ax=ax, base_name="campaign_stopping") ``` ```{image} campaign_stopping_light.svg :align: center :class: only-light ``` ```{image} campaign_stopping_dark.svg :align: center :class: only-dark ```